C18H32O6 — CID 71720667
(1S,2R,6R,8R,9S)-4,4-dimethyl-8-(octoxymethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 71720667) has the molecular formula C18H32O6 and a molecular weight of 344.45 g/mol. Its IUPAC name is (1S,2R,6R,8R,9S)-4,4-dimethyl-8-(octoxymethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (1S,2R,6R,8R,9S)-4,4-dimethyl-8-(octoxymethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 71720667 |
| Molecular Formula | C18H32O6 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | (1S,2R,6R,8R,9S)-4,4-dimethyl-8-(octoxymethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | CCCCCCCCOC[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OCO[C@H]21 |
| InChI | InChI=1S/C18H32O6/c1-4-5-6-7-8-9-10-19-11-13-14-15(21-12-20-14)16-17(22-13)24-18(2,3)23-16/h13-17H,4-12H2,1-3H3/t13-,14+,15+,16-,17-/m1/s1 |
| InChIKey | KEAUDKVYTCBGSS-DRRXZNNHSA-N |
| XLogP | 2.98 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|