C21H21NO2 — CID 71720680
(E)-N-benzyl-4-oxo-4-(5,6,7,8-tetrahydronaphthalen-1-yl)but-2-enamide (PubChem CID 71720680) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is (E)-N-benzyl-4-oxo-4-(5,6,7,8-tetrahydronaphthalen-1-yl)but-2-enamide.
| Compound Name | (E)-N-benzyl-4-oxo-4-(5,6,7,8-tetrahydronaphthalen-1-yl)but-2-enamide |
|---|---|
| PubChem CID | 71720680 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | (E)-N-benzyl-4-oxo-4-(5,6,7,8-tetrahydronaphthalen-1-yl)but-2-enamide |
| SMILES | O=C(/C=C/C(=O)c1cccc2c1CCCC2)NCc1ccccc1 |
| InChI | InChI=1S/C21H21NO2/c23-20(19-12-6-10-17-9-4-5-11-18(17)19)13-14-21(24)22-15-16-7-2-1-3-8-16/h1-3,6-8,10,12-14H,4-5,9,11,15H2,(H,22,24)/b14-13+ |
| InChIKey | UKRBMNSYRJZDPZ-BUHFOSPRSA-N |
| XLogP | 3.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|