C33H32N8O8S — CID 71720695
(2R)-2-[[(2S)-2-[[(2S)-2-[[5-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-1H-pyrazole-3-carbonyl]amino]propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid (PubChem CID 71720695) has the molecular formula C33H32N8O8S and a molecular weight of 700.73 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-[[(2S)-2-[[5-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-1H-pyrazole-3-carbonyl]amino]propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid.
| Compound Name | (2R)-2-[[(2S)-2-[[(2S)-2-[[5-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-1H-pyrazole-3-carbonyl]amino]propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 71720695 |
| Molecular Formula | C33H32N8O8S |
| Molecular Weight | 700.73 g/mol |
| Exact Mass | 700.21 |
| IUPAC Name | (2R)-2-[[(2S)-2-[[(2S)-2-[[5-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-1H-pyrazole-3-carbonyl]amino]propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid |
| SMILES | Cc1nc(NC(=O)c2ccccc2)sc1-c1cc(C(=O)N[C@@H](C)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)N[C@H](CC(=O)O)C(=O)O)n[nH]1 |
| InChI | InChI=1S/C33H32N8O8S/c1-16-27(50-33(36-16)39-29(45)18-8-4-3-5-9-18)22-13-24(41-40-22)31(47)35-17(2)28(44)37-23(30(46)38-25(32(48)49)14-26(42)43)12-19-15-34-21-11-7-6-10-20(19)21/h3-11,13,15,17,23,25,34H,12,14H2,1-2H3,(H,35,47)(H,37,44)(H,38,46)(H,40,41)(H,42,43)(H,48,49)(H,36,39,45)/t17-,23-,25+/m0/s1 |
| InChIKey | INCLJDAWZYNECU-DQXHVOOISA-N |
| XLogP | 2.47 |
| TPSA | 248.36 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.73 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |