C27H32N2O4 — CID 71720709
(1S,2S,13R,18R)-15-(3-methylbut-2-enyl)-18-[(4-methylpiperazin-1-yl)methyl]-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraene-10,14-dione (PubChem CID 71720709) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is (1S,2S,13R,18R)-15-(3-methylbut-2-enyl)-18-[(4-methylpiperazin-1-yl)methyl]-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraene-10,14-dione.
| Compound Name | (1S,2S,13R,18R)-15-(3-methylbut-2-enyl)-18-[(4-methylpiperazin-1-yl)methyl]-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraene-10,14-dione |
|---|---|
| PubChem CID | 71720709 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | (1S,2S,13R,18R)-15-(3-methylbut-2-enyl)-18-[(4-methylpiperazin-1-yl)methyl]-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraene-10,14-dione |
| SMILES | CC(C)=CCC12OC[C@@H]3[C@@H](CN4CCN(C)CC4)[C@@H](C=C4C(=O)c5ccccc5O[C@]431)C2=O |
| InChI | InChI=1S/C27H32N2O4/c1-17(2)8-9-26-25(31)19-14-21-24(30)18-6-4-5-7-23(18)33-27(21,26)22(16-32-26)20(19)15-29-12-10-28(3)11-13-29/h4-8,14,19-20,22H,9-13,15-16H2,1-3H3/t19-,20+,22-,26?,27-/m1/s1 |
| InChIKey | WBLNREHQFBKQOH-ZWPKBPEYSA-N |
| XLogP | 2.74 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|