About 3-chloro-N-[(1S,3S)-3-[[4-(dimethylamino)benzoyl]amino]cyclohexyl]benzamide
3-chloro-N-[(1S,3S)-3-[[4-(dimethylamino)benzoyl]amino]cyclohexyl]benzamide (PubChem CID 71720793) has the molecular formula C22H26ClN3O2
and a molecular weight of 399.92 g/mol. Its IUPAC name is 3-chloro-N-[(1S,3S)-3-[[4-(dimethylamino)benzoyl]amino]cyclohexyl]benzamide.
Molecular Properties
| Compound Name | 3-chloro-N-[(1S,3S)-3-[[4-(dimethylamino)benzoyl]amino]cyclohexyl]benzamide |
| PubChem CID | 71720793 |
| Molecular Formula | C22H26ClN3O2 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 3-chloro-N-[(1S,3S)-3-[[4-(dimethylamino)benzoyl]amino]cyclohexyl]benzamide |
| SMILES | CN(C)c1ccc(C(=O)N[C@H]2CCC[C@H](NC(=O)c3cccc(Cl)c3)C2)cc1 |
| InChI | InChI=1S/C22H26ClN3O2/c1-26(2)20-11-9-15(10-12-20)21(27)24-18-7-4-8-19(14-18)25-22(28)16-5-3-6-17(23)13-16/h3,5-6,9-13,18-19H,4,7-8,14H2,1-2H3,(H,24,27)(H,25,28)/t18-,19-/m0/s1 |
| InChIKey | RSKKUEYUIMNSNS-OALUTQOASA-N |
| XLogP | 3.88 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-N-[(1S,3S)-3-[[4-(dimethylamino)benzoyl]amino]cyclohexyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[(1S,3S)-3-[[4-(dimethylamino)benzoyl]amino]cyclohexyl]benzamide?
The IUPAC name of 3-chloro-N-[(1S,3S)-3-[[4-(dimethylamino)benzoyl]amino]cyclohexyl]benzamide (CID 71720793) is 3-chloro-N-[(1S,3S)-3-[[4-(dimethylamino)benzoyl]amino]cyclohexyl]benzamide.
What is the SMILES notation for 3-chloro-N-[(1S,3S)-3-[[4-(dimethylamino)benzoyl]amino]cyclohexyl]benzamide?
The canonical SMILES for 3-chloro-N-[(1S,3S)-3-[[4-(dimethylamino)benzoyl]amino]cyclohexyl]benzamide is CN(C)c1ccc(C(=O)N[C@H]2CCC[C@H](NC(=O)c3cccc(Cl)c3)C2)cc1.
What is the InChIKey of 3-chloro-N-[(1S,3S)-3-[[4-(dimethylamino)benzoyl]amino]cyclohexyl]benzamide?
The InChIKey is RSKKUEYUIMNSNS-OALUTQOASA-N. The full InChI is InChI=1S/C22H26ClN3O2/c1-26(2)20-11-9-15(10-12-20)21(27)24-18-7-4-8-19(14-18)25-22(28)16-5-3-6-17(23)13-16/h3,5-6,9-13,18-19H,4,7-8,14H2,1-2H3,(H,24,27)(H,25,28)/t18-,19-/m0/s1.
What are the key properties of 3-chloro-N-[(1S,3S)-3-[[4-(dimethylamino)benzoyl]amino]cyclohexyl]benzamide?
3-chloro-N-[(1S,3S)-3-[[4-(dimethylamino)benzoyl]amino]cyclohexyl]benzamide has a molecular weight of 399.92 g/mol, XLogP of 3.88, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[(1S,3S)-3-[[4-(dimethylamino)benzoyl]amino]cyclohexyl]benzamide is sourced from PubChem (CID 71720793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).