C19H26O9 — CID 71720833
(3R,5S)-8-nonyl-9-oxo-1,6-dioxaspiro[4.4]non-7-ene-2,2,3-tricarboxylic acid (PubChem CID 71720833) has the molecular formula C19H26O9 and a molecular weight of 398.41 g/mol. Its IUPAC name is (3R,5S)-8-nonyl-9-oxo-1,6-dioxaspiro[4.4]non-7-ene-2,2,3-tricarboxylic acid.
| Compound Name | (3R,5S)-8-nonyl-9-oxo-1,6-dioxaspiro[4.4]non-7-ene-2,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 71720833 |
| Molecular Formula | C19H26O9 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | (3R,5S)-8-nonyl-9-oxo-1,6-dioxaspiro[4.4]non-7-ene-2,2,3-tricarboxylic acid |
| SMILES | CCCCCCCCCC1=CO[C@]2(C[C@@H](C(=O)O)C(C(=O)O)(C(=O)O)O2)C1=O |
| InChI | InChI=1S/C19H26O9/c1-2-3-4-5-6-7-8-9-12-11-27-18(14(12)20)10-13(15(21)22)19(28-18,16(23)24)17(25)26/h11,13H,2-10H2,1H3,(H,21,22)(H,23,24)(H,25,26)/t13-,18-/m0/s1 |
| InChIKey | HTIFDBUYYFZLJR-UGSOOPFHSA-N |
| XLogP | 2.34 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|