C13H14O5 — CID 71720933
(3E,3aS,6aS)-3-[[(2R)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-4,5-ditritio-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-one (PubChem CID 71720933) has the molecular formula C13H14O5 and a molecular weight of 254.27 g/mol. Its IUPAC name is (3E,3aS,6aS)-3-[[(2R)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-4,5-ditritio-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-one.
| Compound Name | (3E,3aS,6aS)-3-[[(2R)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-4,5-ditritio-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 71720933 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | (3E,3aS,6aS)-3-[[(2R)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-4,5-ditritio-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-one |
| SMILES | [3H]C1C[C@@H]2OC(=O)/C(=C/O[C@H]3C=C(C)C(=O)O3)[C@@H]2C1[3H] |
| InChI | InChI=1S/C13H14O5/c1-7-5-11(18-12(7)14)16-6-9-8-3-2-4-10(8)17-13(9)15/h5-6,8,10-11H,2-4H2,1H3/b9-6+/t8-,10-,11+/m0/s1/i2T,3T/t2?,3?,8-,10-,11+ |
| InChIKey | QLKSFDGUSDSNLG-CVDVIAKHSA-N |
| XLogP | 1.44 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|