About 6-chloro-2,4-dimethylpyridin-3-amine
6-chloro-2,4-dimethylpyridin-3-amine (PubChem CID 71721100) has the molecular formula C7H9ClN2
and a molecular weight of 156.62 g/mol. Its IUPAC name is 6-chloro-2,4-dimethylpyridin-3-amine.
Molecular Properties
| Compound Name | 6-chloro-2,4-dimethylpyridin-3-amine |
| PubChem CID | 71721100 |
| Molecular Formula | C7H9ClN2 |
| Molecular Weight | 156.62 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 6-chloro-2,4-dimethylpyridin-3-amine |
| SMILES | Cc1cc(Cl)nc(C)c1N |
| InChI | InChI=1S/C7H9ClN2/c1-4-3-6(8)10-5(2)7(4)9/h3H,9H2,1-2H3 |
| InChIKey | MRGRJKIGNLUGAT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.62 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2,4-dimethylpyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2,4-dimethylpyridin-3-amine?
The IUPAC name of 6-chloro-2,4-dimethylpyridin-3-amine (CID 71721100) is 6-chloro-2,4-dimethylpyridin-3-amine.
What is the SMILES notation for 6-chloro-2,4-dimethylpyridin-3-amine?
The canonical SMILES for 6-chloro-2,4-dimethylpyridin-3-amine is Cc1cc(Cl)nc(C)c1N.
What is the InChIKey of 6-chloro-2,4-dimethylpyridin-3-amine?
The InChIKey is MRGRJKIGNLUGAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2/c1-4-3-6(8)10-5(2)7(4)9/h3H,9H2,1-2H3.
What are the key properties of 6-chloro-2,4-dimethylpyridin-3-amine?
6-chloro-2,4-dimethylpyridin-3-amine has a molecular weight of 156.62 g/mol, XLogP of 1.93, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2,4-dimethylpyridin-3-amine is sourced from PubChem (CID 71721100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).