About 4-chloro-2,8-dimethylquinazoline
4-chloro-2,8-dimethylquinazoline (PubChem CID 71721381) has the molecular formula C10H9ClN2
and a molecular weight of 192.65 g/mol. Its IUPAC name is 4-chloro-2,8-dimethylquinazoline.
Molecular Properties
| Compound Name | 4-chloro-2,8-dimethylquinazoline |
| PubChem CID | 71721381 |
| Molecular Formula | C10H9ClN2 |
| Molecular Weight | 192.65 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 4-chloro-2,8-dimethylquinazoline |
| SMILES | Cc1nc(Cl)c2cccc(C)c2n1 |
| InChI | InChI=1S/C10H9ClN2/c1-6-4-3-5-8-9(6)12-7(2)13-10(8)11/h3-5H,1-2H3 |
| InChIKey | AYJKZUDPYRCGNM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.65 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-2,8-dimethylquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2,8-dimethylquinazoline?
The IUPAC name of 4-chloro-2,8-dimethylquinazoline (CID 71721381) is 4-chloro-2,8-dimethylquinazoline.
What is the SMILES notation for 4-chloro-2,8-dimethylquinazoline?
The canonical SMILES for 4-chloro-2,8-dimethylquinazoline is Cc1nc(Cl)c2cccc(C)c2n1.
What is the InChIKey of 4-chloro-2,8-dimethylquinazoline?
The InChIKey is AYJKZUDPYRCGNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClN2/c1-6-4-3-5-8-9(6)12-7(2)13-10(8)11/h3-5H,1-2H3.
What are the key properties of 4-chloro-2,8-dimethylquinazoline?
4-chloro-2,8-dimethylquinazoline has a molecular weight of 192.65 g/mol, XLogP of 2.90, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2,8-dimethylquinazoline is sourced from PubChem (CID 71721381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).