C30H45N3O8 — CID 71721764
[1-(hydroxymethyl)-1,4a-dimethyl-6-methylidene-5-[3-nitro-2-(5-oxo-2H-furan-4-yl)propyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] 4-(4-methylpiperazin-1-yl)-4-oxobutanoate (PubChem CID 71721764) has the molecular formula C30H45N3O8 and a molecular weight of 575.70 g/mol. Its IUPAC name is [1-(hydroxymethyl)-1,4a-dimethyl-6-methylidene-5-[3-nitro-2-(5-oxo-2H-furan-4-yl)propyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] 4-(4-methylpiperazin-1-yl)-4-oxobutanoate.
| Compound Name | [1-(hydroxymethyl)-1,4a-dimethyl-6-methylidene-5-[3-nitro-2-(5-oxo-2H-furan-4-yl)propyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] 4-(4-methylpiperazin-1-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 71721764 |
| Molecular Formula | C30H45N3O8 |
| Molecular Weight | 575.70 g/mol |
| Exact Mass | 575.32 |
| IUPAC Name | [1-(hydroxymethyl)-1,4a-dimethyl-6-methylidene-5-[3-nitro-2-(5-oxo-2H-furan-4-yl)propyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] 4-(4-methylpiperazin-1-yl)-4-oxobutanoate |
| SMILES | C=C1CCC2C(C)(CO)C(OC(=O)CCC(=O)N3CCN(C)CC3)CCC2(C)C1CC(C[N+](=O)[O-])C1=CCOC1=O |
| InChI | InChI=1S/C30H45N3O8/c1-20-5-6-24-29(2,23(20)17-21(18-33(38)39)22-10-16-40-28(22)37)11-9-25(30(24,3)19-34)41-27(36)8-7-26(35)32-14-12-31(4)13-15-32/h10,21,23-25,34H,1,5-9,11-19H2,2-4H3 |
| InChIKey | RGLZKCWLOBSVTH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 139.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.70 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|