About 3-chloro-2-ethoxy-3,4-dihydro-2H-thiochromen-4-ol
3-chloro-2-ethoxy-3,4-dihydro-2H-thiochromen-4-ol (PubChem CID 71721974) has the molecular formula C11H13ClO2S
and a molecular weight of 244.74 g/mol. Its IUPAC name is 3-chloro-2-ethoxy-3,4-dihydro-2H-thiochromen-4-ol.
Molecular Properties
| Compound Name | 3-chloro-2-ethoxy-3,4-dihydro-2H-thiochromen-4-ol |
| PubChem CID | 71721974 |
| Molecular Formula | C11H13ClO2S |
| Molecular Weight | 244.74 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 3-chloro-2-ethoxy-3,4-dihydro-2H-thiochromen-4-ol |
| SMILES | CCOC1Sc2ccccc2C(O)C1Cl |
| InChI | InChI=1S/C11H13ClO2S/c1-2-14-11-9(12)10(13)7-5-3-4-6-8(7)15-11/h3-6,9-11,13H,2H2,1H3 |
| InChIKey | NLGZULOSLSTRBY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.74 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2-ethoxy-3,4-dihydro-2H-thiochromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-ethoxy-3,4-dihydro-2H-thiochromen-4-ol?
The IUPAC name of 3-chloro-2-ethoxy-3,4-dihydro-2H-thiochromen-4-ol (CID 71721974) is 3-chloro-2-ethoxy-3,4-dihydro-2H-thiochromen-4-ol.
What is the SMILES notation for 3-chloro-2-ethoxy-3,4-dihydro-2H-thiochromen-4-ol?
The canonical SMILES for 3-chloro-2-ethoxy-3,4-dihydro-2H-thiochromen-4-ol is CCOC1Sc2ccccc2C(O)C1Cl.
What is the InChIKey of 3-chloro-2-ethoxy-3,4-dihydro-2H-thiochromen-4-ol?
The InChIKey is NLGZULOSLSTRBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClO2S/c1-2-14-11-9(12)10(13)7-5-3-4-6-8(7)15-11/h3-6,9-11,13H,2H2,1H3.
What are the key properties of 3-chloro-2-ethoxy-3,4-dihydro-2H-thiochromen-4-ol?
3-chloro-2-ethoxy-3,4-dihydro-2H-thiochromen-4-ol has a molecular weight of 244.74 g/mol, XLogP of 2.80, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-ethoxy-3,4-dihydro-2H-thiochromen-4-ol is sourced from PubChem (CID 71721974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).