C30H27N5O — CID 71722031
4-(3,5-dimethylpyrazol-1-yl)-7-(4-methoxyphenyl)-5,6-diphenyl-4a,7a-dihydropyrrolo[2,3-d]pyrimidine (PubChem CID 71722031) has the molecular formula C30H27N5O and a molecular weight of 473.58 g/mol. Its IUPAC name is 4-(3,5-dimethylpyrazol-1-yl)-7-(4-methoxyphenyl)-5,6-diphenyl-4a,7a-dihydropyrrolo[2,3-d]pyrimidine.
| Compound Name | 4-(3,5-dimethylpyrazol-1-yl)-7-(4-methoxyphenyl)-5,6-diphenyl-4a,7a-dihydropyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 71722031 |
| Molecular Formula | C30H27N5O |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 4-(3,5-dimethylpyrazol-1-yl)-7-(4-methoxyphenyl)-5,6-diphenyl-4a,7a-dihydropyrrolo[2,3-d]pyrimidine |
| SMILES | COc1ccc(N2C(c3ccccc3)=C(c3ccccc3)C3C(n4nc(C)cc4C)=NC=NC32)cc1 |
| InChI | InChI=1S/C30H27N5O/c1-20-18-21(2)35(33-20)30-27-26(22-10-6-4-7-11-22)28(23-12-8-5-9-13-23)34(29(27)31-19-32-30)24-14-16-25(36-3)17-15-24/h4-19,27,29H,1-3H3 |
| InChIKey | FPWFGFJGEYWJOF-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 55.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|