C14H23F2NO3 — CID 71722162
methyl (2Z)-2-[(dibutylamino)methylidene]-4,4-difluoro-3-oxobutanoate (PubChem CID 71722162) has the molecular formula C14H23F2NO3 and a molecular weight of 291.34 g/mol. Its IUPAC name is methyl (2Z)-2-[(dibutylamino)methylidene]-4,4-difluoro-3-oxobutanoate.
| Compound Name | methyl (2Z)-2-[(dibutylamino)methylidene]-4,4-difluoro-3-oxobutanoate |
|---|---|
| PubChem CID | 71722162 |
| Molecular Formula | C14H23F2NO3 |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | methyl (2Z)-2-[(dibutylamino)methylidene]-4,4-difluoro-3-oxobutanoate |
| SMILES | CCCCN(/C=C(\C(=O)OC)C(=O)C(F)F)CCCC |
| InChI | InChI=1S/C14H23F2NO3/c1-4-6-8-17(9-7-5-2)10-11(14(19)20-3)12(18)13(15)16/h10,13H,4-9H2,1-3H3/b11-10- |
| InChIKey | LCDNAQXUCWVLAE-KHPPLWFESA-N |
| XLogP | 2.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|