C36H27NO3 — CID 71722384
11-benzyl-14,15-bis(4-methoxyphenyl)-1-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,8,10,13(16),14-heptaen-12-one (PubChem CID 71722384) has the molecular formula C36H27NO3 and a molecular weight of 521.62 g/mol. Its IUPAC name is 11-benzyl-14,15-bis(4-methoxyphenyl)-1-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,8,10,13(16),14-heptaen-12-one.
| Compound Name | 11-benzyl-14,15-bis(4-methoxyphenyl)-1-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,8,10,13(16),14-heptaen-12-one |
|---|---|
| PubChem CID | 71722384 |
| Molecular Formula | C36H27NO3 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | 11-benzyl-14,15-bis(4-methoxyphenyl)-1-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,8,10,13(16),14-heptaen-12-one |
| SMILES | COc1ccc(-c2c(-c3ccc(OC)cc3)n3c4ccccc4cc4cc(Cc5ccccc5)c(=O)c2c43)cc1 |
| InChI | InChI=1S/C36H27NO3/c1-39-29-16-12-24(13-17-29)32-33-35-27(22-28(36(33)38)20-23-8-4-3-5-9-23)21-26-10-6-7-11-31(26)37(35)34(32)25-14-18-30(40-2)19-15-25/h3-19,21-22H,20H2,1-2H3 |
| InChIKey | MFOQSBCCGJVWHB-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|