C18H22FNO2S — CID 71722403
(4Z)-4-(1-fluoroethylidene)-2-(4-methylphenyl)sulfonyl-1,3,4a,5,6,7-hexahydroisoquinoline (PubChem CID 71722403) has the molecular formula C18H22FNO2S and a molecular weight of 335.44 g/mol. Its IUPAC name is (4Z)-4-(1-fluoroethylidene)-2-(4-methylphenyl)sulfonyl-1,3,4a,5,6,7-hexahydroisoquinoline.
| Compound Name | (4Z)-4-(1-fluoroethylidene)-2-(4-methylphenyl)sulfonyl-1,3,4a,5,6,7-hexahydroisoquinoline |
|---|---|
| PubChem CID | 71722403 |
| Molecular Formula | C18H22FNO2S |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | (4Z)-4-(1-fluoroethylidene)-2-(4-methylphenyl)sulfonyl-1,3,4a,5,6,7-hexahydroisoquinoline |
| SMILES | C/C(F)=C1/CN(S(=O)(=O)c2ccc(C)cc2)CC2=CCCCC21 |
| InChI | InChI=1S/C18H22FNO2S/c1-13-7-9-16(10-8-13)23(21,22)20-11-15-5-3-4-6-17(15)18(12-20)14(2)19/h5,7-10,17H,3-4,6,11-12H2,1-2H3/b18-14+ |
| InChIKey | GYXDZTGWTKATOB-NBVRZTHBSA-N |
| XLogP | 3.97 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|