C27H40N10O4S — CID 71722448
(2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[[(2S)-2-[(4-carbamimidoylphenyl)methylsulfonylamino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanamide (PubChem CID 71722448) has the molecular formula C27H40N10O4S and a molecular weight of 600.75 g/mol. Its IUPAC name is (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[[(2S)-2-[(4-carbamimidoylphenyl)methylsulfonylamino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanamide.
| Compound Name | (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[[(2S)-2-[(4-carbamimidoylphenyl)methylsulfonylamino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 71722448 |
| Molecular Formula | C27H40N10O4S |
| Molecular Weight | 600.75 g/mol |
| Exact Mass | 600.30 |
| IUPAC Name | (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[[(2S)-2-[(4-carbamimidoylphenyl)methylsulfonylamino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](NS(=O)(=O)Cc2ccc(/C(N)=N/[H])cc2)C(C)C)cc1 |
| InChI | InChI=1S/C27H40N10O4S/c1-16(2)22(37-42(40,41)15-18-7-11-20(12-8-18)24(30)31)26(39)36-21(4-3-13-34-27(32)33)25(38)35-14-17-5-9-19(10-6-17)23(28)29/h5-12,16,21-22,37H,3-4,13-15H2,1-2H3,(H3,28,29)(H3,30,31)(H,35,38)(H,36,39)(H4,32,33,34)/t21-,22-/m0/s1 |
| InChIKey | PRSVXIFOXDFBKT-VXKWHMMOSA-N |
| XLogP | -0.45 |
| TPSA | 268.51 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.75 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|