About (2R,3R)-oxirane-2,3-dicarboxylate
(2R,3R)-oxirane-2,3-dicarboxylate (PubChem CID 7172291) has the molecular formula C4H2O5-2
and a molecular weight of 130.05 g/mol. Its IUPAC name is (2R,3R)-oxirane-2,3-dicarboxylate.
Molecular Properties
| Compound Name | (2R,3R)-oxirane-2,3-dicarboxylate |
| PubChem CID | 7172291 |
| Molecular Formula | C4H2O5-2 |
| Molecular Weight | 130.05 g/mol |
| Exact Mass | 129.99 |
| IUPAC Name | (2R,3R)-oxirane-2,3-dicarboxylate |
| SMILES | O=C([O-])[C@@H]1O[C@H]1C(=O)[O-] |
| InChI | InChI=1S/C4H4O5/c5-3(6)1-2(9-1)4(7)8/h1-2H,(H,5,6)(H,7,8)/p-2/t1-,2-/m1/s1 |
| InChIKey | DCEMCPAKSGRHCN-JCYAYHJZSA-L |
| XLogP | -3.75 |
| TPSA | 92.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.05 |
| LogP ≤ 5 | -3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-oxirane-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-oxirane-2,3-dicarboxylate?
The IUPAC name of (2R,3R)-oxirane-2,3-dicarboxylate (CID 7172291) is (2R,3R)-oxirane-2,3-dicarboxylate.
What is the SMILES notation for (2R,3R)-oxirane-2,3-dicarboxylate?
The canonical SMILES for (2R,3R)-oxirane-2,3-dicarboxylate is O=C([O-])[C@@H]1O[C@H]1C(=O)[O-].
What is the InChIKey of (2R,3R)-oxirane-2,3-dicarboxylate?
The InChIKey is DCEMCPAKSGRHCN-JCYAYHJZSA-L. The full InChI is InChI=1S/C4H4O5/c5-3(6)1-2(9-1)4(7)8/h1-2H,(H,5,6)(H,7,8)/p-2/t1-,2-/m1/s1.
What are the key properties of (2R,3R)-oxirane-2,3-dicarboxylate?
(2R,3R)-oxirane-2,3-dicarboxylate has a molecular weight of 130.05 g/mol, XLogP of -3.75, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-oxirane-2,3-dicarboxylate is sourced from PubChem (CID 7172291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).