C15H13ClN4O2S — CID 71723171
4-[[4-(4-chlorophenyl)triazol-1-yl]methyl]benzenesulfonamide (PubChem CID 71723171) has the molecular formula C15H13ClN4O2S and a molecular weight of 348.82 g/mol. Its IUPAC name is 4-[[4-(4-chlorophenyl)triazol-1-yl]methyl]benzenesulfonamide.
| Compound Name | 4-[[4-(4-chlorophenyl)triazol-1-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 71723171 |
| Molecular Formula | C15H13ClN4O2S |
| Molecular Weight | 348.82 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 4-[[4-(4-chlorophenyl)triazol-1-yl]methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Cn2cc(-c3ccc(Cl)cc3)nn2)cc1 |
| InChI | InChI=1S/C15H13ClN4O2S/c16-13-5-3-12(4-6-13)15-10-20(19-18-15)9-11-1-7-14(8-2-11)23(17,21)22/h1-8,10H,9H2,(H2,17,21,22) |
| InChIKey | LYHTZPYTBPFEHF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.82 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |