About 2-chloro-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazoline
2-chloro-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazoline (PubChem CID 7172328) has the molecular formula C9H8ClF3N2
and a molecular weight of 236.62 g/mol. Its IUPAC name is 2-chloro-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazoline.
Molecular Properties
| Compound Name | 2-chloro-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazoline |
| PubChem CID | 7172328 |
| Molecular Formula | C9H8ClF3N2 |
| Molecular Weight | 236.62 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 2-chloro-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazoline |
| SMILES | FC(F)(F)c1nc(Cl)nc2c1CCCC2 |
| InChI | InChI=1S/C9H8ClF3N2/c10-8-14-6-4-2-1-3-5(6)7(15-8)9(11,12)13/h1-4H2 |
| InChIKey | POCQYMUTNWQJLH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.62 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazoline?
The IUPAC name of 2-chloro-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazoline (CID 7172328) is 2-chloro-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazoline.
What is the SMILES notation for 2-chloro-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazoline?
The canonical SMILES for 2-chloro-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazoline is FC(F)(F)c1nc(Cl)nc2c1CCCC2.
What is the InChIKey of 2-chloro-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazoline?
The InChIKey is POCQYMUTNWQJLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClF3N2/c10-8-14-6-4-2-1-3-5(6)7(15-8)9(11,12)13/h1-4H2.
What are the key properties of 2-chloro-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazoline?
2-chloro-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazoline has a molecular weight of 236.62 g/mol, XLogP of 3.03, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazoline is sourced from PubChem (CID 7172328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).