C30H47NO7Si — CID 71723382
(4S)-4-benzyl-3-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,5R)-2,2-dimethyl-5-[(E)-3-methylbut-1-enyl]-1,3-dioxolan-4-yl]-2-methoxypropanoyl]-1,3-oxazolidin-2-one (PubChem CID 71723382) has the molecular formula C30H47NO7Si and a molecular weight of 561.79 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,5R)-2,2-dimethyl-5-[(E)-3-methylbut-1-enyl]-1,3-dioxolan-4-yl]-2-methoxypropanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,5R)-2,2-dimethyl-5-[(E)-3-methylbut-1-enyl]-1,3-dioxolan-4-yl]-2-methoxypropanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 71723382 |
| Molecular Formula | C30H47NO7Si |
| Molecular Weight | 561.79 g/mol |
| Exact Mass | 561.31 |
| IUPAC Name | (4S)-4-benzyl-3-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,5R)-2,2-dimethyl-5-[(E)-3-methylbut-1-enyl]-1,3-dioxolan-4-yl]-2-methoxypropanoyl]-1,3-oxazolidin-2-one |
| SMILES | CO[C@H](C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)(C)O[C@@H]1/C=C/C(C)C |
| InChI | InChI=1S/C30H47NO7Si/c1-20(2)16-17-23-24(37-30(6,7)36-23)25(38-39(9,10)29(3,4)5)26(34-8)27(32)31-22(19-35-28(31)33)18-21-14-12-11-13-15-21/h11-17,20,22-26H,18-19H2,1-10H3/b17-16+/t22-,23+,24-,25+,26-/m0/s1 |
| InChIKey | MNHRFZWOWUYJKZ-IUGQSEQOSA-N |
| XLogP | 5.71 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.79 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|