About N-[1-(2,5-dimethoxyphenyl)ethylidene]hydroxylamine
N-[1-(2,5-dimethoxyphenyl)ethylidene]hydroxylamine (PubChem CID 7172382) has the molecular formula C10H13NO3
and a molecular weight of 195.22 g/mol. Its IUPAC name is N-[1-(2,5-dimethoxyphenyl)ethylidene]hydroxylamine.
Molecular Properties
| Compound Name | N-[1-(2,5-dimethoxyphenyl)ethylidene]hydroxylamine |
| PubChem CID | 7172382 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | N-[1-(2,5-dimethoxyphenyl)ethylidene]hydroxylamine |
| SMILES | COc1ccc(OC)c(C(C)=NO)c1 |
| InChI | InChI=1S/C10H13NO3/c1-7(11-12)9-6-8(13-2)4-5-10(9)14-3/h4-6,12H,1-3H3 |
| InChIKey | JDEJVZRCMSXTBW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(2,5-dimethoxyphenyl)ethylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2,5-dimethoxyphenyl)ethylidene]hydroxylamine?
The IUPAC name of N-[1-(2,5-dimethoxyphenyl)ethylidene]hydroxylamine (CID 7172382) is N-[1-(2,5-dimethoxyphenyl)ethylidene]hydroxylamine.
What is the SMILES notation for N-[1-(2,5-dimethoxyphenyl)ethylidene]hydroxylamine?
The canonical SMILES for N-[1-(2,5-dimethoxyphenyl)ethylidene]hydroxylamine is COc1ccc(OC)c(C(C)=NO)c1.
What is the InChIKey of N-[1-(2,5-dimethoxyphenyl)ethylidene]hydroxylamine?
The InChIKey is JDEJVZRCMSXTBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3/c1-7(11-12)9-6-8(13-2)4-5-10(9)14-3/h4-6,12H,1-3H3.
What are the key properties of N-[1-(2,5-dimethoxyphenyl)ethylidene]hydroxylamine?
N-[1-(2,5-dimethoxyphenyl)ethylidene]hydroxylamine has a molecular weight of 195.22 g/mol, XLogP of 1.90, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2,5-dimethoxyphenyl)ethylidene]hydroxylamine is sourced from PubChem (CID 7172382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).