About 3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-dimethylurea
3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-dimethylurea (PubChem CID 71723871) has the molecular formula C25H26N2O3
and a molecular weight of 402.49 g/mol. Its IUPAC name is 3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-dimethylurea |
| PubChem CID | 71723871 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-dimethylurea |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ccc(NC(=O)N(C)C)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C25H26N2O3/c1-4-23(17-7-13-21(28)14-8-17)24(19-9-15-22(29)16-10-19)18-5-11-20(12-6-18)26-25(30)27(2)3/h5-16,28-29H,4H2,1-3H3,(H,26,30)/b24-23+ |
| InChIKey | LVTWNSIMQDNKLU-WCWDXBQESA-N |
| XLogP | 5.56 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-dimethylurea?
The IUPAC name of 3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-dimethylurea (CID 71723871) is 3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-dimethylurea.
What is the SMILES notation for 3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-dimethylurea?
The canonical SMILES for 3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-dimethylurea is CC/C(=C(\c1ccc(O)cc1)c1ccc(NC(=O)N(C)C)cc1)c1ccc(O)cc1.
What is the InChIKey of 3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-dimethylurea?
The InChIKey is LVTWNSIMQDNKLU-WCWDXBQESA-N. The full InChI is InChI=1S/C25H26N2O3/c1-4-23(17-7-13-21(28)14-8-17)24(19-9-15-22(29)16-10-19)18-5-11-20(12-6-18)26-25(30)27(2)3/h5-16,28-29H,4H2,1-3H3,(H,26,30)/b24-23+.
What are the key properties of 3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-dimethylurea?
3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-dimethylurea has a molecular weight of 402.49 g/mol, XLogP of 5.56, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-dimethylurea is sourced from PubChem (CID 71723871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).