About 3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-diethylurea
3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-diethylurea (PubChem CID 71723872) has the molecular formula C27H30N2O3
and a molecular weight of 430.55 g/mol. Its IUPAC name is 3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-diethylurea.
Molecular Properties
| Compound Name | 3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-diethylurea |
| PubChem CID | 71723872 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-diethylurea |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ccc(NC(=O)N(CC)CC)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C27H30N2O3/c1-4-25(19-9-15-23(30)16-10-19)26(21-11-17-24(31)18-12-21)20-7-13-22(14-8-20)28-27(32)29(5-2)6-3/h7-18,30-31H,4-6H2,1-3H3,(H,28,32)/b26-25+ |
| InChIKey | AIVKYNZWBHXJLN-OCEACIFDSA-N |
| XLogP | 6.34 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-diethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-diethylurea?
The IUPAC name of 3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-diethylurea (CID 71723872) is 3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-diethylurea.
What is the SMILES notation for 3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-diethylurea?
The canonical SMILES for 3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-diethylurea is CC/C(=C(\c1ccc(O)cc1)c1ccc(NC(=O)N(CC)CC)cc1)c1ccc(O)cc1.
What is the InChIKey of 3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-diethylurea?
The InChIKey is AIVKYNZWBHXJLN-OCEACIFDSA-N. The full InChI is InChI=1S/C27H30N2O3/c1-4-25(19-9-15-23(30)16-10-19)26(21-11-17-24(31)18-12-21)20-7-13-22(14-8-20)28-27(32)29(5-2)6-3/h7-18,30-31H,4-6H2,1-3H3,(H,28,32)/b26-25+.
What are the key properties of 3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-diethylurea?
3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-diethylurea has a molecular weight of 430.55 g/mol, XLogP of 6.34, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]-1,1-diethylurea is sourced from PubChem (CID 71723872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).