About N-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]pyrrolidine-1-carboxamide
N-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]pyrrolidine-1-carboxamide (PubChem CID 71723873) has the molecular formula C27H28N2O3
and a molecular weight of 428.53 g/mol. Its IUPAC name is N-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]pyrrolidine-1-carboxamide.
Molecular Properties
| Compound Name | N-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]pyrrolidine-1-carboxamide |
| PubChem CID | 71723873 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | N-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]pyrrolidine-1-carboxamide |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ccc(NC(=O)N2CCCC2)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C27H28N2O3/c1-2-25(19-7-13-23(30)14-8-19)26(21-9-15-24(31)16-10-21)20-5-11-22(12-6-20)28-27(32)29-17-3-4-18-29/h5-16,30-31H,2-4,17-18H2,1H3,(H,28,32)/b26-25+ |
| InChIKey | RDDXLNXKLXZMLM-OCEACIFDSA-N |
| XLogP | 6.09 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]pyrrolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]pyrrolidine-1-carboxamide?
The IUPAC name of N-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]pyrrolidine-1-carboxamide (CID 71723873) is N-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]pyrrolidine-1-carboxamide.
What is the SMILES notation for N-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]pyrrolidine-1-carboxamide?
The canonical SMILES for N-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]pyrrolidine-1-carboxamide is CC/C(=C(\c1ccc(O)cc1)c1ccc(NC(=O)N2CCCC2)cc1)c1ccc(O)cc1.
What is the InChIKey of N-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]pyrrolidine-1-carboxamide?
The InChIKey is RDDXLNXKLXZMLM-OCEACIFDSA-N. The full InChI is InChI=1S/C27H28N2O3/c1-2-25(19-7-13-23(30)14-8-19)26(21-9-15-24(31)16-10-21)20-5-11-22(12-6-20)28-27(32)29-17-3-4-18-29/h5-16,30-31H,2-4,17-18H2,1H3,(H,28,32)/b26-25+.
What are the key properties of N-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]pyrrolidine-1-carboxamide?
N-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]pyrrolidine-1-carboxamide has a molecular weight of 428.53 g/mol, XLogP of 6.09, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(E)-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]pyrrolidine-1-carboxamide is sourced from PubChem (CID 71723873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).