C25H19BrCl2N6O3 — CID 71724082
[(E)-[amino-(2-methylphenyl)methylidene]amino] 2-[[3-bromo-1-(3-chloro-2-pyridinyl)pyrazole-5-carbonyl]amino]-5-chloro-3-methylbenzoate (PubChem CID 71724082) has the molecular formula C25H19BrCl2N6O3 and a molecular weight of 602.28 g/mol. Its IUPAC name is [(E)-[amino-(2-methylphenyl)methylidene]amino] 2-[[3-bromo-1-(3-chloro-2-pyridinyl)pyrazole-5-carbonyl]amino]-5-chloro-3-methylbenzoate.
| Compound Name | [(E)-[amino-(2-methylphenyl)methylidene]amino] 2-[[3-bromo-1-(3-chloro-2-pyridinyl)pyrazole-5-carbonyl]amino]-5-chloro-3-methylbenzoate |
|---|---|
| PubChem CID | 71724082 |
| Molecular Formula | C25H19BrCl2N6O3 |
| Molecular Weight | 602.28 g/mol |
| Exact Mass | 600.01 |
| IUPAC Name | [(E)-[amino-(2-methylphenyl)methylidene]amino] 2-[[3-bromo-1-(3-chloro-2-pyridinyl)pyrazole-5-carbonyl]amino]-5-chloro-3-methylbenzoate |
| SMILES | Cc1ccccc1/C(N)=N\OC(=O)c1cc(Cl)cc(C)c1NC(=O)c1cc(Br)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C25H19BrCl2N6O3/c1-13-6-3-4-7-16(13)22(29)33-37-25(36)17-11-15(27)10-14(2)21(17)31-24(35)19-12-20(26)32-34(19)23-18(28)8-5-9-30-23/h3-12H,1-2H3,(H2,29,33)(H,31,35) |
| InChIKey | HUCJKGHUSIYPMX-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 124.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.28 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|