C25H42O2Si — CID 71724201
(1S,2S,5S,6S,7R)-5-[8-[tert-butyl(dimethyl)silyl]oxyoctyl]-4-methylidenetricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 71724201) has the molecular formula C25H42O2Si and a molecular weight of 402.70 g/mol. Its IUPAC name is (1S,2S,5S,6S,7R)-5-[8-[tert-butyl(dimethyl)silyl]oxyoctyl]-4-methylidenetricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | (1S,2S,5S,6S,7R)-5-[8-[tert-butyl(dimethyl)silyl]oxyoctyl]-4-methylidenetricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 71724201 |
| Molecular Formula | C25H42O2Si |
| Molecular Weight | 402.70 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | (1S,2S,5S,6S,7R)-5-[8-[tert-butyl(dimethyl)silyl]oxyoctyl]-4-methylidenetricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | C=C1C(=O)[C@@H]2[C@H]([C@@H]1CCCCCCCCO[Si](C)(C)C(C)(C)C)[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C25H42O2Si/c1-18-21(22-19-14-15-20(17-19)23(22)24(18)26)13-11-9-7-8-10-12-16-27-28(5,6)25(2,3)4/h14-15,19-23H,1,7-13,16-17H2,2-6H3/t19-,20+,21+,22-,23-/m0/s1 |
| InChIKey | CIPFMJDCGKVVTP-NQQQLTFYSA-N |
| XLogP | 6.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.70 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|