C16H10NO3S3- — CID 7172431
2-[4-[(5E)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]phenyl]acetate (PubChem CID 7172431) has the molecular formula C16H10NO3S3- and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-[4-[(5E)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]phenyl]acetate.
| Compound Name | 2-[4-[(5E)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]phenyl]acetate |
|---|---|
| PubChem CID | 7172431 |
| Molecular Formula | C16H10NO3S3- |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | 2-[4-[(5E)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]phenyl]acetate |
| SMILES | O=C([O-])Cc1ccc(N2C(=O)/C(=C\c3cccs3)SC2=S)cc1 |
| InChI | InChI=1S/C16H11NO3S3/c18-14(19)8-10-3-5-11(6-4-10)17-15(20)13(23-16(17)21)9-12-2-1-7-22-12/h1-7,9H,8H2,(H,18,19)/p-1/b13-9+ |
| InChIKey | YFWSCMUZSHKEPU-UKTHLTGXSA-M |
| XLogP | 2.45 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|