C21H25N3O4 — CID 71724455
1-[5-(6-amino-2,3,4-trimethoxyphenyl)-3,4-dihydropyrazol-2-yl]-3-phenylpropan-1-one (PubChem CID 71724455) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is 1-[5-(6-amino-2,3,4-trimethoxyphenyl)-3,4-dihydropyrazol-2-yl]-3-phenylpropan-1-one.
| Compound Name | 1-[5-(6-amino-2,3,4-trimethoxyphenyl)-3,4-dihydropyrazol-2-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 71724455 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 1-[5-(6-amino-2,3,4-trimethoxyphenyl)-3,4-dihydropyrazol-2-yl]-3-phenylpropan-1-one |
| SMILES | COc1cc(N)c(C2=NN(C(=O)CCc3ccccc3)CC2)c(OC)c1OC |
| InChI | InChI=1S/C21H25N3O4/c1-26-17-13-15(22)19(21(28-3)20(17)27-2)16-11-12-24(23-16)18(25)10-9-14-7-5-4-6-8-14/h4-8,13H,9-12,22H2,1-3H3 |
| InChIKey | ZDVCPPWZNPDCNV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|