C14H16N4O7S — CID 71724611
[(2R,5S)-2-(benzamidocarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 71724611) has the molecular formula C14H16N4O7S and a molecular weight of 384.37 g/mol. Its IUPAC name is [(2R,5S)-2-(benzamidocarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2R,5S)-2-(benzamidocarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 71724611 |
| Molecular Formula | C14H16N4O7S |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | [(2R,5S)-2-(benzamidocarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C(NNC(=O)[C@H]1CC[C@H]2CN1C(=O)N2OS(=O)(=O)O)c1ccccc1 |
| InChI | InChI=1S/C14H16N4O7S/c19-12(9-4-2-1-3-5-9)15-16-13(20)11-7-6-10-8-17(11)14(21)18(10)25-26(22,23)24/h1-5,10-11H,6-8H2,(H,15,19)(H,16,20)(H,22,23,24)/t10-,11+/m0/s1 |
| InChIKey | UUEDZUADIJTHCX-WDEREUQCSA-N |
| XLogP | -0.55 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|