C30H31BrN2O2S2 — CID 71724674
3-[2-[(E)-2-[4-(4-methylsulfanylphenyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]ethenyl]-6,7-dihydro-1,3-benzothiazol-3-ium-3-yl]propanoic acid bromide (PubChem CID 71724674) has the molecular formula C30H31BrN2O2S2 and a molecular weight of 595.63 g/mol. Its IUPAC name is 3-[2-[(E)-2-[4-(4-methylsulfanylphenyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]ethenyl]-6,7-dihydro-1,3-benzothiazol-3-ium-3-yl]propanoic acid bromide.
| Compound Name | 3-[2-[(E)-2-[4-(4-methylsulfanylphenyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]ethenyl]-6,7-dihydro-1,3-benzothiazol-3-ium-3-yl]propanoic acid bromide |
|---|---|
| PubChem CID | 71724674 |
| Molecular Formula | C30H31BrN2O2S2 |
| Molecular Weight | 595.63 g/mol |
| Exact Mass | 594.10 |
| IUPAC Name | 3-[2-[(E)-2-[4-(4-methylsulfanylphenyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]ethenyl]-6,7-dihydro-1,3-benzothiazol-3-ium-3-yl]propanoic acid bromide |
| SMILES | CSc1ccc(N2c3ccc(/C=C/c4sc5c([n+]4CCC(=O)O)C=CCC5)cc3C3CCCC32)cc1.[Br-] |
| InChI | InChI=1S/C30H30N2O2S2.BrH/c1-35-22-13-11-21(12-14-22)32-25-7-4-5-23(25)24-19-20(9-15-26(24)32)10-16-29-31(18-17-30(33)34)27-6-2-3-8-28(27)36-29;/h2,6,9-16,19,23,25H,3-5,7-8,17-18H2,1H3;1H |
| InChIKey | FAQGHIVSBQHGRA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 44.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.63 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|