C23H27N3O3 — CID 71725059
[4-[2-(3-methoxyphenoxy)ethyl]piperazin-1-yl]-(3-methyl-1H-indol-2-yl)methanone (PubChem CID 71725059) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is [4-[2-(3-methoxyphenoxy)ethyl]piperazin-1-yl]-(3-methyl-1H-indol-2-yl)methanone.
| Compound Name | [4-[2-(3-methoxyphenoxy)ethyl]piperazin-1-yl]-(3-methyl-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 71725059 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | [4-[2-(3-methoxyphenoxy)ethyl]piperazin-1-yl]-(3-methyl-1H-indol-2-yl)methanone |
| SMILES | COc1cccc(OCCN2CCN(C(=O)c3[nH]c4ccccc4c3C)CC2)c1 |
| InChI | InChI=1S/C23H27N3O3/c1-17-20-8-3-4-9-21(20)24-22(17)23(27)26-12-10-25(11-13-26)14-15-29-19-7-5-6-18(16-19)28-2/h3-9,16,24H,10-15H2,1-2H3 |
| InChIKey | UUMLEYKLLJNTQZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|