C15H22O4 — CID 71725146
(3R,6R,7R,11S)-11-ethyl-3-hydroxy-3,7-dimethyl-5-methylidene-1-oxaspiro[5.5]undecane-2,4-dione (PubChem CID 71725146) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (3R,6R,7R,11S)-11-ethyl-3-hydroxy-3,7-dimethyl-5-methylidene-1-oxaspiro[5.5]undecane-2,4-dione.
| Compound Name | (3R,6R,7R,11S)-11-ethyl-3-hydroxy-3,7-dimethyl-5-methylidene-1-oxaspiro[5.5]undecane-2,4-dione |
|---|---|
| PubChem CID | 71725146 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (3R,6R,7R,11S)-11-ethyl-3-hydroxy-3,7-dimethyl-5-methylidene-1-oxaspiro[5.5]undecane-2,4-dione |
| SMILES | C=C1C(=O)[C@@](C)(O)C(=O)O[C@]12[C@@H](CC)CCC[C@H]2C |
| InChI | InChI=1S/C15H22O4/c1-5-11-8-6-7-9(2)15(11)10(3)12(16)14(4,18)13(17)19-15/h9,11,18H,3,5-8H2,1-2,4H3/t9-,11+,14-,15+/m1/s1 |
| InChIKey | BOSZFTJTEITMLK-QFEPDWEUSA-N |
| XLogP | 2.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|