About 4-ethyl-1-methyl-1,2,4-triazol-4-ium iodide
4-ethyl-1-methyl-1,2,4-triazol-4-ium iodide (PubChem CID 71725552) has the molecular formula C5H10IN3
and a molecular weight of 239.06 g/mol. Its IUPAC name is 4-ethyl-1-methyl-1,2,4-triazol-4-ium iodide.
Molecular Properties
| Compound Name | 4-ethyl-1-methyl-1,2,4-triazol-4-ium iodide |
| PubChem CID | 71725552 |
| Molecular Formula | C5H10IN3 |
| Molecular Weight | 239.06 g/mol |
| Exact Mass | 238.99 |
| IUPAC Name | 4-ethyl-1-methyl-1,2,4-triazol-4-ium iodide |
| SMILES | CC[n+]1cnn(C)c1.[I-] |
| InChI | InChI=1S/C5H10N3.HI/c1-3-8-4-6-7(2)5-8;/h4-5H,3H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | DKMVWMYJBAQEIU-UHFFFAOYSA-M |
| XLogP | -3.27 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.06 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-1-methyl-1,2,4-triazol-4-ium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1-methyl-1,2,4-triazol-4-ium iodide?
The IUPAC name of 4-ethyl-1-methyl-1,2,4-triazol-4-ium iodide (CID 71725552) is 4-ethyl-1-methyl-1,2,4-triazol-4-ium iodide.
What is the SMILES notation for 4-ethyl-1-methyl-1,2,4-triazol-4-ium iodide?
The canonical SMILES for 4-ethyl-1-methyl-1,2,4-triazol-4-ium iodide is CC[n+]1cnn(C)c1.[I-].
What is the InChIKey of 4-ethyl-1-methyl-1,2,4-triazol-4-ium iodide?
The InChIKey is DKMVWMYJBAQEIU-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H10N3.HI/c1-3-8-4-6-7(2)5-8;/h4-5H,3H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 4-ethyl-1-methyl-1,2,4-triazol-4-ium iodide?
4-ethyl-1-methyl-1,2,4-triazol-4-ium iodide has a molecular weight of 239.06 g/mol, XLogP of -3.27, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1-methyl-1,2,4-triazol-4-ium iodide is sourced from PubChem (CID 71725552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).