C27H38O10 — CID 71725619
methyl 2-[(4aS,4bS,5S,8aR,9S,10R,10aR)-5,9,10-triacetyloxy-8a-hydroxy-1,4b,8,8-tetramethyl-3-oxo-4,4a,5,6,7,9,10,10a-octahydrophenanthren-2-yl]acetate (PubChem CID 71725619) has the molecular formula C27H38O10 and a molecular weight of 522.59 g/mol. Its IUPAC name is methyl 2-[(4aS,4bS,5S,8aR,9S,10R,10aR)-5,9,10-triacetyloxy-8a-hydroxy-1,4b,8,8-tetramethyl-3-oxo-4,4a,5,6,7,9,10,10a-octahydrophenanthren-2-yl]acetate.
| Compound Name | methyl 2-[(4aS,4bS,5S,8aR,9S,10R,10aR)-5,9,10-triacetyloxy-8a-hydroxy-1,4b,8,8-tetramethyl-3-oxo-4,4a,5,6,7,9,10,10a-octahydrophenanthren-2-yl]acetate |
|---|---|
| PubChem CID | 71725619 |
| Molecular Formula | C27H38O10 |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | methyl 2-[(4aS,4bS,5S,8aR,9S,10R,10aR)-5,9,10-triacetyloxy-8a-hydroxy-1,4b,8,8-tetramethyl-3-oxo-4,4a,5,6,7,9,10,10a-octahydrophenanthren-2-yl]acetate |
| SMILES | COC(=O)CC1=C(C)[C@@H]2[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@]3(O)C(C)(C)CC[C@H](OC(C)=O)[C@]3(C)[C@H]2CC1=O |
| InChI | InChI=1S/C27H38O10/c1-13-17(11-21(32)34-8)19(31)12-18-22(13)23(36-15(3)29)24(37-16(4)30)27(33)25(5,6)10-9-20(26(18,27)7)35-14(2)28/h18,20,22-24,33H,9-12H2,1-8H3/t18-,20-,22-,23+,24-,26-,27+/m0/s1 |
| InChIKey | YCPYGLZZONLPAF-YTVANOEUSA-N |
| XLogP | 2.44 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|