C22H34O3 — CID 71725772
[(1R,4aS,4bS,5R,7R,10aR)-7-ethenyl-5-hydroxy-1,4a,7-trimethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-1-yl]methyl acetate (PubChem CID 71725772) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is [(1R,4aS,4bS,5R,7R,10aR)-7-ethenyl-5-hydroxy-1,4a,7-trimethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-1-yl]methyl acetate.
| Compound Name | [(1R,4aS,4bS,5R,7R,10aR)-7-ethenyl-5-hydroxy-1,4a,7-trimethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-1-yl]methyl acetate |
|---|---|
| PubChem CID | 71725772 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | [(1R,4aS,4bS,5R,7R,10aR)-7-ethenyl-5-hydroxy-1,4a,7-trimethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-1-yl]methyl acetate |
| SMILES | C=C[C@]1(C)C=C2CC[C@H]3[C@](C)(COC(C)=O)CCC[C@]3(C)[C@H]2[C@H](O)C1 |
| InChI | InChI=1S/C22H34O3/c1-6-20(3)12-16-8-9-18-21(4,14-25-15(2)23)10-7-11-22(18,5)19(16)17(24)13-20/h6,12,17-19,24H,1,7-11,13-14H2,2-5H3/t17-,18+,19-,20-,21+,22+/m1/s1 |
| InChIKey | IVVWNRFCVBBZAF-HJEMKOJISA-N |
| XLogP | 4.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|