C23H24O2 — CID 71725838
(1S,6R,7R,9S)-11-methylidene-7,9-diphenyl-10,12-dioxatricyclo[7.2.1.01,6]dodecane (PubChem CID 71725838) has the molecular formula C23H24O2 and a molecular weight of 332.44 g/mol. Its IUPAC name is (1S,6R,7R,9S)-11-methylidene-7,9-diphenyl-10,12-dioxatricyclo[7.2.1.01,6]dodecane.
| Compound Name | (1S,6R,7R,9S)-11-methylidene-7,9-diphenyl-10,12-dioxatricyclo[7.2.1.01,6]dodecane |
|---|---|
| PubChem CID | 71725838 |
| Molecular Formula | C23H24O2 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | (1S,6R,7R,9S)-11-methylidene-7,9-diphenyl-10,12-dioxatricyclo[7.2.1.01,6]dodecane |
| SMILES | C=C1O[C@@]2(c3ccccc3)C[C@@H](c3ccccc3)[C@H]3CCCC[C@@]13O2 |
| InChI | InChI=1S/C23H24O2/c1-17-22-15-9-8-14-21(22)20(18-10-4-2-5-11-18)16-23(24-17,25-22)19-12-6-3-7-13-19/h2-7,10-13,20-21H,1,8-9,14-16H2/t20-,21+,22+,23-/m0/s1 |
| InChIKey | RDFCHPRDXQEHIJ-AFXVXQJMSA-N |
| XLogP | 5.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |