C20H42O3Si2 — CID 71725889
(E,2R,3R,6S,7R)-2,4,6-trimethyl-7-triethylsilyloxy-3-trimethylsilyloxyoct-4-enal (PubChem CID 71725889) has the molecular formula C20H42O3Si2 and a molecular weight of 386.73 g/mol. Its IUPAC name is (E,2R,3R,6S,7R)-2,4,6-trimethyl-7-triethylsilyloxy-3-trimethylsilyloxyoct-4-enal.
| Compound Name | (E,2R,3R,6S,7R)-2,4,6-trimethyl-7-triethylsilyloxy-3-trimethylsilyloxyoct-4-enal |
|---|---|
| PubChem CID | 71725889 |
| Molecular Formula | C20H42O3Si2 |
| Molecular Weight | 386.73 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | (E,2R,3R,6S,7R)-2,4,6-trimethyl-7-triethylsilyloxy-3-trimethylsilyloxyoct-4-enal |
| SMILES | CC[Si](CC)(CC)O[C@H](C)[C@@H](C)/C=C(\C)[C@H](O[Si](C)(C)C)[C@@H](C)C=O |
| InChI | InChI=1S/C20H42O3Si2/c1-11-25(12-2,13-3)22-19(7)16(4)14-17(5)20(18(6)15-21)23-24(8,9)10/h14-16,18-20H,11-13H2,1-10H3/b17-14+/t16-,18-,19+,20-/m0/s1 |
| InChIKey | DMAXQPPIWSKLOR-KNGAEFBGSA-N |
| XLogP | 6.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.73 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|