C11H13BrFNOS — CID 71726061
(NE,S)-N-[(2-bromo-6-fluorophenyl)methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 71726061) has the molecular formula C11H13BrFNOS and a molecular weight of 306.20 g/mol. Its IUPAC name is (NE,S)-N-[(2-bromo-6-fluorophenyl)methylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,S)-N-[(2-bromo-6-fluorophenyl)methylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 71726061 |
| Molecular Formula | C11H13BrFNOS |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | (NE,S)-N-[(2-bromo-6-fluorophenyl)methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@](=O)/N=C/c1c(F)cccc1Br |
| InChI | InChI=1S/C11H13BrFNOS/c1-11(2,3)16(15)14-7-8-9(12)5-4-6-10(8)13/h4-7H,1-3H3/b14-7+/t16-/m0/s1 |
| InChIKey | JHUCUBHEKDXYJW-KAMPRCONSA-N |
| XLogP | 3.47 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|