C19H26O2 — CID 71726324
(4aS,10aR)-7-(1-hydroxyethyl)-1,1,4a-trimethyl-4,9,10,10a-tetrahydro-3H-phenanthren-2-one (PubChem CID 71726324) has the molecular formula C19H26O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is (4aS,10aR)-7-(1-hydroxyethyl)-1,1,4a-trimethyl-4,9,10,10a-tetrahydro-3H-phenanthren-2-one.
| Compound Name | (4aS,10aR)-7-(1-hydroxyethyl)-1,1,4a-trimethyl-4,9,10,10a-tetrahydro-3H-phenanthren-2-one |
|---|---|
| PubChem CID | 71726324 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (4aS,10aR)-7-(1-hydroxyethyl)-1,1,4a-trimethyl-4,9,10,10a-tetrahydro-3H-phenanthren-2-one |
| SMILES | CC(O)c1ccc2c(c1)CC[C@H]1C(C)(C)C(=O)CC[C@]21C |
| InChI | InChI=1S/C19H26O2/c1-12(20)13-5-7-15-14(11-13)6-8-16-18(2,3)17(21)9-10-19(15,16)4/h5,7,11-12,16,20H,6,8-10H2,1-4H3/t12?,16-,19+/m0/s1 |
| InChIKey | PMCHCEBDFNHJBI-KIPKWITQSA-N |
| XLogP | 3.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |