C12H13NO6 — CID 71726384
(1R,5R,6S,9R)-9-(furan-2-yl)-6-hydroxy-5-nitro-3-oxabicyclo[3.3.1]nonan-2-one (PubChem CID 71726384) has the molecular formula C12H13NO6 and a molecular weight of 267.24 g/mol. Its IUPAC name is (1R,5R,6S,9R)-9-(furan-2-yl)-6-hydroxy-5-nitro-3-oxabicyclo[3.3.1]nonan-2-one.
| Compound Name | (1R,5R,6S,9R)-9-(furan-2-yl)-6-hydroxy-5-nitro-3-oxabicyclo[3.3.1]nonan-2-one |
|---|---|
| PubChem CID | 71726384 |
| Molecular Formula | C12H13NO6 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | (1R,5R,6S,9R)-9-(furan-2-yl)-6-hydroxy-5-nitro-3-oxabicyclo[3.3.1]nonan-2-one |
| SMILES | O=C1OC[C@]2([N+](=O)[O-])[C@H](c3ccco3)[C@H]1CC[C@@H]2O |
| InChI | InChI=1S/C12H13NO6/c14-9-4-3-7-10(8-2-1-5-18-8)12(9,13(16)17)6-19-11(7)15/h1-2,5,7,9-10,14H,3-4,6H2/t7-,9+,10+,12-/m1/s1 |
| InChIKey | CDXAAOVOGMJGJK-WCXZBXRPSA-N |
| XLogP | 0.71 |
| TPSA | 102.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|