C29H30N2O6 — CID 71726559
(5R)-5-benzyl-N-[(3,5-dimethoxyphenyl)methyl]-2,4-dioxo-3-[(1R)-1-phenylpropyl]-1,3-oxazolidine-5-carboxamide (PubChem CID 71726559) has the molecular formula C29H30N2O6 and a molecular weight of 502.57 g/mol. Its IUPAC name is (5R)-5-benzyl-N-[(3,5-dimethoxyphenyl)methyl]-2,4-dioxo-3-[(1R)-1-phenylpropyl]-1,3-oxazolidine-5-carboxamide.
| Compound Name | (5R)-5-benzyl-N-[(3,5-dimethoxyphenyl)methyl]-2,4-dioxo-3-[(1R)-1-phenylpropyl]-1,3-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 71726559 |
| Molecular Formula | C29H30N2O6 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | (5R)-5-benzyl-N-[(3,5-dimethoxyphenyl)methyl]-2,4-dioxo-3-[(1R)-1-phenylpropyl]-1,3-oxazolidine-5-carboxamide |
| SMILES | CC[C@H](c1ccccc1)N1C(=O)O[C@](Cc2ccccc2)(C(=O)NCc2cc(OC)cc(OC)c2)C1=O |
| InChI | InChI=1S/C29H30N2O6/c1-4-25(22-13-9-6-10-14-22)31-27(33)29(37-28(31)34,18-20-11-7-5-8-12-20)26(32)30-19-21-15-23(35-2)17-24(16-21)36-3/h5-17,25H,4,18-19H2,1-3H3,(H,30,32)/t25-,29-/m1/s1 |
| InChIKey | SQSRDMBFJGPFMP-VAVYLYDRSA-N |
| XLogP | 4.43 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|