C33H32O5 — CID 71726564
(1R,2R,3E)-3-benzylidene-2-(3,5-dimethoxyphenyl)-5,7-dimethoxy-1-(4-methoxyphenyl)-1,2-dihydroindene (PubChem CID 71726564) has the molecular formula C33H32O5 and a molecular weight of 508.61 g/mol. Its IUPAC name is (1R,2R,3E)-3-benzylidene-2-(3,5-dimethoxyphenyl)-5,7-dimethoxy-1-(4-methoxyphenyl)-1,2-dihydroindene.
| Compound Name | (1R,2R,3E)-3-benzylidene-2-(3,5-dimethoxyphenyl)-5,7-dimethoxy-1-(4-methoxyphenyl)-1,2-dihydroindene |
|---|---|
| PubChem CID | 71726564 |
| Molecular Formula | C33H32O5 |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | (1R,2R,3E)-3-benzylidene-2-(3,5-dimethoxyphenyl)-5,7-dimethoxy-1-(4-methoxyphenyl)-1,2-dihydroindene |
| SMILES | COc1ccc([C@@H]2c3c(OC)cc(OC)cc3/C(=C/c3ccccc3)[C@H]2c2cc(OC)cc(OC)c2)cc1 |
| InChI | InChI=1S/C33H32O5/c1-34-24-13-11-22(12-14-24)32-31(23-16-25(35-2)18-26(17-23)36-3)28(15-21-9-7-6-8-10-21)29-19-27(37-4)20-30(38-5)33(29)32/h6-20,31-32H,1-5H3/b28-15-/t31-,32+/m1/s1 |
| InChIKey | XEERTHHWBBYJMC-SJKHITPFSA-N |
| XLogP | 7.20 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|