About N'-(5-methylsulfonylpentyl)propane-1,3-diamine;dihydrochloride
N'-(5-methylsulfonylpentyl)propane-1,3-diamine;dihydrochloride (PubChem CID 71726583) has the molecular formula C9H24Cl2N2O2S
and a molecular weight of 295.28 g/mol. Its IUPAC name is N'-(5-methylsulfonylpentyl)propane-1,3-diamine;dihydrochloride.
Molecular Properties
| Compound Name | N'-(5-methylsulfonylpentyl)propane-1,3-diamine;dihydrochloride |
| PubChem CID | 71726583 |
| Molecular Formula | C9H24Cl2N2O2S |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | N'-(5-methylsulfonylpentyl)propane-1,3-diamine;dihydrochloride |
| SMILES | CS(=O)(=O)CCCCCNCCCN.Cl.Cl |
| InChI | InChI=1S/C9H22N2O2S.2ClH/c1-14(12,13)9-4-2-3-7-11-8-5-6-10;;/h11H,2-10H2,1H3;2*1H |
| InChIKey | YABGXEXIXWDOQO-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(5-methylsulfonylpentyl)propane-1,3-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5-methylsulfonylpentyl)propane-1,3-diamine;dihydrochloride?
The IUPAC name of N'-(5-methylsulfonylpentyl)propane-1,3-diamine;dihydrochloride (CID 71726583) is N'-(5-methylsulfonylpentyl)propane-1,3-diamine;dihydrochloride.
What is the SMILES notation for N'-(5-methylsulfonylpentyl)propane-1,3-diamine;dihydrochloride?
The canonical SMILES for N'-(5-methylsulfonylpentyl)propane-1,3-diamine;dihydrochloride is CS(=O)(=O)CCCCCNCCCN.Cl.Cl.
What is the InChIKey of N'-(5-methylsulfonylpentyl)propane-1,3-diamine;dihydrochloride?
The InChIKey is YABGXEXIXWDOQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N2O2S.2ClH/c1-14(12,13)9-4-2-3-7-11-8-5-6-10;;/h11H,2-10H2,1H3;2*1H.
What are the key properties of N'-(5-methylsulfonylpentyl)propane-1,3-diamine;dihydrochloride?
N'-(5-methylsulfonylpentyl)propane-1,3-diamine;dihydrochloride has a molecular weight of 295.28 g/mol, XLogP of 0.98, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5-methylsulfonylpentyl)propane-1,3-diamine;dihydrochloride is sourced from PubChem (CID 71726583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).