C21H36O3 — CID 71727085
(1S,4E,6R,8R,9E,11S,14S)-8-methoxy-4,8,14-trimethyl-11-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,9-dien-6-ol (PubChem CID 71727085) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is (1S,4E,6R,8R,9E,11S,14S)-8-methoxy-4,8,14-trimethyl-11-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,9-dien-6-ol.
| Compound Name | (1S,4E,6R,8R,9E,11S,14S)-8-methoxy-4,8,14-trimethyl-11-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,9-dien-6-ol |
|---|---|
| PubChem CID | 71727085 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | (1S,4E,6R,8R,9E,11S,14S)-8-methoxy-4,8,14-trimethyl-11-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,9-dien-6-ol |
| SMILES | CO[C@@]1(C)/C=C/[C@H](C(C)C)CC[C@]2(C)O[C@H]2CC/C(C)=C/[C@H](O)C1 |
| InChI | InChI=1S/C21H36O3/c1-15(2)17-9-11-20(4,23-6)14-18(22)13-16(3)7-8-19-21(5,24-19)12-10-17/h9,11,13,15,17-19,22H,7-8,10,12,14H2,1-6H3/b11-9+,16-13+/t17-,18-,19-,20-,21-/m0/s1 |
| InChIKey | HQHLVTSBJKWZJN-GCIKCWJASA-N |
| XLogP | 4.65 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|