C20H30S — CID 71727208
(2E,6E,10S,11R)-3,7,13-trimethyl-10-propan-2-yl-15-thiabicyclo[9.3.1]pentadeca-1(14),2,6,12-tetraene (PubChem CID 71727208) has the molecular formula C20H30S and a molecular weight of 302.53 g/mol. Its IUPAC name is (2E,6E,10S,11R)-3,7,13-trimethyl-10-propan-2-yl-15-thiabicyclo[9.3.1]pentadeca-1(14),2,6,12-tetraene.
| Compound Name | (2E,6E,10S,11R)-3,7,13-trimethyl-10-propan-2-yl-15-thiabicyclo[9.3.1]pentadeca-1(14),2,6,12-tetraene |
|---|---|
| PubChem CID | 71727208 |
| Molecular Formula | C20H30S |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | (2E,6E,10S,11R)-3,7,13-trimethyl-10-propan-2-yl-15-thiabicyclo[9.3.1]pentadeca-1(14),2,6,12-tetraene |
| SMILES | CC1=C[C@@H]2SC(=C1)/C=C(/C)CC/C=C(/C)CC[C@H]2C(C)C |
| InChI | InChI=1S/C20H30S/c1-14(2)19-10-9-15(3)7-6-8-16(4)11-18-12-17(5)13-20(19)21-18/h7,11-14,19-20H,6,8-10H2,1-5H3/b15-7-,16-11-/t19-,20-/m0/s1 |
| InChIKey | CDCCHUJOQQLBNW-MCDBKOBUSA-N |
| XLogP | 6.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|