C28H25FN4O7S — CID 71727335
1-N'-[4-(2,3-dimethoxyquinoxalin-5-yl)oxy-3-fluorophenyl]-1-N-(4-methylsulfonylphenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 71727335) has the molecular formula C28H25FN4O7S and a molecular weight of 580.59 g/mol. Its IUPAC name is 1-N'-[4-(2,3-dimethoxyquinoxalin-5-yl)oxy-3-fluorophenyl]-1-N-(4-methylsulfonylphenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[4-(2,3-dimethoxyquinoxalin-5-yl)oxy-3-fluorophenyl]-1-N-(4-methylsulfonylphenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 71727335 |
| Molecular Formula | C28H25FN4O7S |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 580.14 |
| IUPAC Name | 1-N'-[4-(2,3-dimethoxyquinoxalin-5-yl)oxy-3-fluorophenyl]-1-N-(4-methylsulfonylphenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | COc1nc2cccc(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(S(C)(=O)=O)cc5)CC4)cc3F)c2nc1OC |
| InChI | InChI=1S/C28H25FN4O7S/c1-38-24-25(39-2)33-23-20(32-24)5-4-6-22(23)40-21-12-9-17(15-19(21)29)31-27(35)28(13-14-28)26(34)30-16-7-10-18(11-8-16)41(3,36)37/h4-12,15H,13-14H2,1-3H3,(H,30,34)(H,31,35) |
| InChIKey | YKAYGLIJBNXOJF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 145.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|