C20H18Cl2F3N5O2 — CID 71727390
5-[1-(4-amino-2,2-difluorooxolan-3-yl)pyrazol-4-yl]-3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine (PubChem CID 71727390) has the molecular formula C20H18Cl2F3N5O2 and a molecular weight of 488.30 g/mol. Its IUPAC name is 5-[1-(4-amino-2,2-difluorooxolan-3-yl)pyrazol-4-yl]-3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine.
| Compound Name | 5-[1-(4-amino-2,2-difluorooxolan-3-yl)pyrazol-4-yl]-3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine |
|---|---|
| PubChem CID | 71727390 |
| Molecular Formula | C20H18Cl2F3N5O2 |
| Molecular Weight | 488.30 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | 5-[1-(4-amino-2,2-difluorooxolan-3-yl)pyrazol-4-yl]-3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine |
| SMILES | C[C@@H](Oc1cc(-c2cnn(C3C(N)COC3(F)F)c2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C20H18Cl2F3N5O2/c1-9(16-12(21)2-3-13(23)17(16)22)32-15-4-10(5-28-19(15)27)11-6-29-30(7-11)18-14(26)8-31-20(18,24)25/h2-7,9,14,18H,8,26H2,1H3,(H2,27,28)/t9-,14?,18?/m1/s1 |
| InChIKey | LPUVFMZYCVONPX-QIAVGSENSA-N |
| XLogP | 4.60 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.30 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|