About 4-[1-(3,4-dichlorophenyl)-2-ethoxyethyl]piperidine;hydrochloride
4-[1-(3,4-dichlorophenyl)-2-ethoxyethyl]piperidine;hydrochloride (PubChem CID 71727756) has the molecular formula C15H22Cl3NO
and a molecular weight of 338.71 g/mol. Its IUPAC name is 4-[1-(3,4-dichlorophenyl)-2-ethoxyethyl]piperidine;hydrochloride.
Molecular Properties
| Compound Name | 4-[1-(3,4-dichlorophenyl)-2-ethoxyethyl]piperidine;hydrochloride |
| PubChem CID | 71727756 |
| Molecular Formula | C15H22Cl3NO |
| Molecular Weight | 338.71 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 4-[1-(3,4-dichlorophenyl)-2-ethoxyethyl]piperidine;hydrochloride |
| SMILES | CCOCC(c1ccc(Cl)c(Cl)c1)C1CCNCC1.Cl |
| InChI | InChI=1S/C15H21Cl2NO.ClH/c1-2-19-10-13(11-5-7-18-8-6-11)12-3-4-14(16)15(17)9-12;/h3-4,9,11,13,18H,2,5-8,10H2,1H3;1H |
| InChIKey | DEYDFIXCTXWVHT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.71 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[1-(3,4-dichlorophenyl)-2-ethoxyethyl]piperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(3,4-dichlorophenyl)-2-ethoxyethyl]piperidine;hydrochloride?
The IUPAC name of 4-[1-(3,4-dichlorophenyl)-2-ethoxyethyl]piperidine;hydrochloride (CID 71727756) is 4-[1-(3,4-dichlorophenyl)-2-ethoxyethyl]piperidine;hydrochloride.
What is the SMILES notation for 4-[1-(3,4-dichlorophenyl)-2-ethoxyethyl]piperidine;hydrochloride?
The canonical SMILES for 4-[1-(3,4-dichlorophenyl)-2-ethoxyethyl]piperidine;hydrochloride is CCOCC(c1ccc(Cl)c(Cl)c1)C1CCNCC1.Cl.
What is the InChIKey of 4-[1-(3,4-dichlorophenyl)-2-ethoxyethyl]piperidine;hydrochloride?
The InChIKey is DEYDFIXCTXWVHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21Cl2NO.ClH/c1-2-19-10-13(11-5-7-18-8-6-11)12-3-4-14(16)15(17)9-12;/h3-4,9,11,13,18H,2,5-8,10H2,1H3;1H.
What are the key properties of 4-[1-(3,4-dichlorophenyl)-2-ethoxyethyl]piperidine;hydrochloride?
4-[1-(3,4-dichlorophenyl)-2-ethoxyethyl]piperidine;hydrochloride has a molecular weight of 338.71 g/mol, XLogP of 4.53, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(3,4-dichlorophenyl)-2-ethoxyethyl]piperidine;hydrochloride is sourced from PubChem (CID 71727756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).