About 4-[1-(3,4-dichlorophenyl)-2-methylsulfonylethyl]piperidine;hydrochloride
4-[1-(3,4-dichlorophenyl)-2-methylsulfonylethyl]piperidine;hydrochloride (PubChem CID 71727762) has the molecular formula C14H20Cl3NO2S
and a molecular weight of 372.75 g/mol. Its IUPAC name is 4-[1-(3,4-dichlorophenyl)-2-methylsulfonylethyl]piperidine;hydrochloride.
Molecular Properties
| Compound Name | 4-[1-(3,4-dichlorophenyl)-2-methylsulfonylethyl]piperidine;hydrochloride |
| PubChem CID | 71727762 |
| Molecular Formula | C14H20Cl3NO2S |
| Molecular Weight | 372.75 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 4-[1-(3,4-dichlorophenyl)-2-methylsulfonylethyl]piperidine;hydrochloride |
| SMILES | CS(=O)(=O)CC(c1ccc(Cl)c(Cl)c1)C1CCNCC1.Cl |
| InChI | InChI=1S/C14H19Cl2NO2S.ClH/c1-20(18,19)9-12(10-4-6-17-7-5-10)11-2-3-13(15)14(16)8-11;/h2-3,8,10,12,17H,4-7,9H2,1H3;1H |
| InChIKey | RPURJJSUIZKBOK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.75 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[1-(3,4-dichlorophenyl)-2-methylsulfonylethyl]piperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(3,4-dichlorophenyl)-2-methylsulfonylethyl]piperidine;hydrochloride?
The IUPAC name of 4-[1-(3,4-dichlorophenyl)-2-methylsulfonylethyl]piperidine;hydrochloride (CID 71727762) is 4-[1-(3,4-dichlorophenyl)-2-methylsulfonylethyl]piperidine;hydrochloride.
What is the SMILES notation for 4-[1-(3,4-dichlorophenyl)-2-methylsulfonylethyl]piperidine;hydrochloride?
The canonical SMILES for 4-[1-(3,4-dichlorophenyl)-2-methylsulfonylethyl]piperidine;hydrochloride is CS(=O)(=O)CC(c1ccc(Cl)c(Cl)c1)C1CCNCC1.Cl.
What is the InChIKey of 4-[1-(3,4-dichlorophenyl)-2-methylsulfonylethyl]piperidine;hydrochloride?
The InChIKey is RPURJJSUIZKBOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19Cl2NO2S.ClH/c1-20(18,19)9-12(10-4-6-17-7-5-10)11-2-3-13(15)14(16)8-11;/h2-3,8,10,12,17H,4-7,9H2,1H3;1H.
What are the key properties of 4-[1-(3,4-dichlorophenyl)-2-methylsulfonylethyl]piperidine;hydrochloride?
4-[1-(3,4-dichlorophenyl)-2-methylsulfonylethyl]piperidine;hydrochloride has a molecular weight of 372.75 g/mol, XLogP of 3.54, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(3,4-dichlorophenyl)-2-methylsulfonylethyl]piperidine;hydrochloride is sourced from PubChem (CID 71727762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).