About ethyl 2-(3,4-dichlorophenyl)-2-piperidin-4-ylacetate;hydrochloride
ethyl 2-(3,4-dichlorophenyl)-2-piperidin-4-ylacetate;hydrochloride (PubChem CID 71727766) has the molecular formula C15H20Cl3NO2
and a molecular weight of 352.69 g/mol. Its IUPAC name is ethyl 2-(3,4-dichlorophenyl)-2-piperidin-4-ylacetate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 2-(3,4-dichlorophenyl)-2-piperidin-4-ylacetate;hydrochloride |
| PubChem CID | 71727766 |
| Molecular Formula | C15H20Cl3NO2 |
| Molecular Weight | 352.69 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | ethyl 2-(3,4-dichlorophenyl)-2-piperidin-4-ylacetate;hydrochloride |
| SMILES | CCOC(=O)C(c1ccc(Cl)c(Cl)c1)C1CCNCC1.Cl |
| InChI | InChI=1S/C15H19Cl2NO2.ClH/c1-2-20-15(19)14(10-5-7-18-8-6-10)11-3-4-12(16)13(17)9-11;/h3-4,9-10,14,18H,2,5-8H2,1H3;1H |
| InChIKey | PSMAIUZEWLCYGR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.69 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-(3,4-dichlorophenyl)-2-piperidin-4-ylacetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(3,4-dichlorophenyl)-2-piperidin-4-ylacetate;hydrochloride?
The IUPAC name of ethyl 2-(3,4-dichlorophenyl)-2-piperidin-4-ylacetate;hydrochloride (CID 71727766) is ethyl 2-(3,4-dichlorophenyl)-2-piperidin-4-ylacetate;hydrochloride.
What is the SMILES notation for ethyl 2-(3,4-dichlorophenyl)-2-piperidin-4-ylacetate;hydrochloride?
The canonical SMILES for ethyl 2-(3,4-dichlorophenyl)-2-piperidin-4-ylacetate;hydrochloride is CCOC(=O)C(c1ccc(Cl)c(Cl)c1)C1CCNCC1.Cl.
What is the InChIKey of ethyl 2-(3,4-dichlorophenyl)-2-piperidin-4-ylacetate;hydrochloride?
The InChIKey is PSMAIUZEWLCYGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19Cl2NO2.ClH/c1-2-20-15(19)14(10-5-7-18-8-6-10)11-3-4-12(16)13(17)9-11;/h3-4,9-10,14,18H,2,5-8H2,1H3;1H.
What are the key properties of ethyl 2-(3,4-dichlorophenyl)-2-piperidin-4-ylacetate;hydrochloride?
ethyl 2-(3,4-dichlorophenyl)-2-piperidin-4-ylacetate;hydrochloride has a molecular weight of 352.69 g/mol, XLogP of 4.06, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(3,4-dichlorophenyl)-2-piperidin-4-ylacetate;hydrochloride is sourced from PubChem (CID 71727766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).